C17H24F2 — CID 118861553
2,3-difluoro-1-methyl-4-[(E)-4-propylhept-5-enyl]benzene (PubChem CID 118861553) has the molecular formula C17H24F2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2,3-difluoro-1-methyl-4-[(E)-4-propylhept-5-enyl]benzene.
| Compound Name | 2,3-difluoro-1-methyl-4-[(E)-4-propylhept-5-enyl]benzene |
|---|---|
| PubChem CID | 118861553 |
| Molecular Formula | C17H24F2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2,3-difluoro-1-methyl-4-[(E)-4-propylhept-5-enyl]benzene |
| SMILES | C/C=C/C(CCC)CCCc1ccc(C)c(F)c1F |
| InChI | InChI=1S/C17H24F2/c1-4-7-14(8-5-2)9-6-10-15-12-11-13(3)16(18)17(15)19/h4,7,11-12,14H,5-6,8-10H2,1-3H3/b7-4+ |
| InChIKey | UNWKFQFUOUGHEB-QPJJXVBHSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|