C20H25FO2 — CID 158597970
4-[5-(2-fluoro-4-methylphenyl)-3-methylpentyl]-2-methoxyphenol (PubChem CID 158597970) has the molecular formula C20H25FO2 and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-[5-(2-fluoro-4-methylphenyl)-3-methylpentyl]-2-methoxyphenol.
| Compound Name | 4-[5-(2-fluoro-4-methylphenyl)-3-methylpentyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 158597970 |
| Molecular Formula | C20H25FO2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 4-[5-(2-fluoro-4-methylphenyl)-3-methylpentyl]-2-methoxyphenol |
| SMILES | COc1cc(CCC(C)CCc2ccc(C)cc2F)ccc1O |
| InChI | InChI=1S/C20H25FO2/c1-14(5-9-17-10-6-15(2)12-18(17)21)4-7-16-8-11-19(22)20(13-16)23-3/h6,8,10-14,22H,4-5,7,9H2,1-3H3 |
| InChIKey | HVGSEQXLZGYLSX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |