C36H48F4O — CID 143772796
(3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidene-2-pent-4-enoxydocosa-1,3,7,11,14-pentaene (PubChem CID 143772796) has the molecular formula C36H48F4O and a molecular weight of 572.77 g/mol. Its IUPAC name is (3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidene-2-pent-4-enoxydocosa-1,3,7,11,14-pentaene.
| Compound Name | (3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidene-2-pent-4-enoxydocosa-1,3,7,11,14-pentaene |
|---|---|
| PubChem CID | 143772796 |
| Molecular Formula | C36H48F4O |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.36 |
| IUPAC Name | (3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidene-2-pent-4-enoxydocosa-1,3,7,11,14-pentaene |
| SMILES | C=CCCCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)/C(C)=C/CC(C)C(C)CCC(C)C |
| InChI | InChI=1S/C36H48F4O/c1-13-14-15-22-41-32(12)36(40)35(39)31(11)28(8)21-20-27(7)30(10)34(38)33(37)29(9)26(6)19-18-25(5)24(4)17-16-23(2)3/h13,19-21,23-25H,1,7-12,14-18,22H2,2-6H3/b21-20-,26-19+,34-33-,36-35- |
| InChIKey | GOPJCYRLYXTPFN-ZWBGYMNXSA-N |
| XLogP | 12.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|