C29H36F4 — CID 143772883
ethene;(3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-2,14,17-trimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11,14-pentaene (PubChem CID 143772883) has the molecular formula C29H36F4 and a molecular weight of 460.60 g/mol. Its IUPAC name is ethene;(3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-2,14,17-trimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11,14-pentaene.
| Compound Name | ethene;(3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-2,14,17-trimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11,14-pentaene |
|---|---|
| PubChem CID | 143772883 |
| Molecular Formula | C29H36F4 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | ethene;(3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-2,14,17-trimethyl-5,6,9,10,13-pentamethylidenenonadeca-1,3,7,11,14-pentaene |
| SMILES | C=C.C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)/C(C)=C/CC(C)CC)C(=C)/C(F)=C(/F)C(=C)C |
| InChI | InChI=1S/C27H32F4.C2H4/c1-11-17(4)12-13-18(5)22(9)26(30)27(31)23(10)20(7)15-14-19(6)21(8)25(29)24(28)16(2)3;1-2/h13-15,17H,2,6-12H2,1,3-5H3;1-2H2/b15-14-,18-13+,25-24-,27-26-; |
| InChIKey | ACVWRWAPIJWGFL-JEOZXFNZSA-N |
| XLogP | 10.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|