C15H29N — CID 145373050
N-(3-methylbutyl)-N-propylhepta-1,6-dien-2-amine (PubChem CID 145373050) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is N-(3-methylbutyl)-N-propylhepta-1,6-dien-2-amine.
| Compound Name | N-(3-methylbutyl)-N-propylhepta-1,6-dien-2-amine |
|---|---|
| PubChem CID | 145373050 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | N-(3-methylbutyl)-N-propylhepta-1,6-dien-2-amine |
| SMILES | C=CCCCC(=C)N(CCC)CCC(C)C |
| InChI | InChI=1S/C15H29N/c1-6-8-9-10-15(5)16(12-7-2)13-11-14(3)4/h6,14H,1,5,7-13H2,2-4H3 |
| InChIKey | WHVNWIVTGMBWDZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|