C12H23N — CID 143366441
N-methyl-N-(2-methylbutyl)hexa-1,5-dien-2-amine (PubChem CID 143366441) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-methyl-N-(2-methylbutyl)hexa-1,5-dien-2-amine.
| Compound Name | N-methyl-N-(2-methylbutyl)hexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 143366441 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-methyl-N-(2-methylbutyl)hexa-1,5-dien-2-amine |
| SMILES | C=CCCC(=C)N(C)CC(C)CC |
| InChI | InChI=1S/C12H23N/c1-6-8-9-12(4)13(5)10-11(3)7-2/h6,11H,1,4,7-10H2,2-3,5H3 |
| InChIKey | SYHIXOZCLBOMJJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|