C6H13N3 — CID 171097369
N,N-diaminohexa-1,5-dien-2-amine (PubChem CID 171097369) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is N,N-diaminohexa-1,5-dien-2-amine.
| Compound Name | N,N-diaminohexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 171097369 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | N,N-diaminohexa-1,5-dien-2-amine |
| SMILES | C=CCCC(=C)N(N)N |
| InChI | InChI=1S/C6H13N3/c1-3-4-5-6(2)9(7)8/h3H,1-2,4-5,7-8H2 |
| InChIKey | BZFINZRSQNSODS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|