C9H16N2 — CID 87329046
2-prop-2-enylhexa-1,5-diene-1,1-diamine (PubChem CID 87329046) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-prop-2-enylhexa-1,5-diene-1,1-diamine.
| Compound Name | 2-prop-2-enylhexa-1,5-diene-1,1-diamine |
|---|---|
| PubChem CID | 87329046 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-prop-2-enylhexa-1,5-diene-1,1-diamine |
| SMILES | C=CCCC(CC=C)=C(N)N |
| InChI | InChI=1S/C9H16N2/c1-3-5-7-8(6-4-2)9(10)11/h3-4H,1-2,5-7,10-11H2 |
| InChIKey | ZEVQUOOZGAMLAX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|