C10H15N — CID 174731019
4-prop-2-enylhepta-1,3,6-trien-3-amine (PubChem CID 174731019) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 4-prop-2-enylhepta-1,3,6-trien-3-amine.
| Compound Name | 4-prop-2-enylhepta-1,3,6-trien-3-amine |
|---|---|
| PubChem CID | 174731019 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 4-prop-2-enylhepta-1,3,6-trien-3-amine |
| SMILES | C=CCC(CC=C)=C(N)C=C |
| InChI | InChI=1S/C10H15N/c1-4-7-9(8-5-2)10(11)6-3/h4-6H,1-3,7-8,11H2 |
| InChIKey | CALKMUKPRBQWKZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|