About hex-5-enethioamide
hex-5-enethioamide (PubChem CID 88640967) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is hex-5-enethioamide.
Molecular Properties
| Compound Name | hex-5-enethioamide |
| PubChem CID | 88640967 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | hex-5-enethioamide |
| SMILES | C=CCCCC(N)=S |
| InChI | InChI=1S/C6H11NS/c1-2-3-4-5-6(7)8/h2H,1,3-5H2,(H2,7,8) |
| InChIKey | BHEZSCZLWDURSI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze hex-5-enethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-enethioamide?
The IUPAC name of hex-5-enethioamide (CID 88640967) is hex-5-enethioamide.
What is the SMILES notation for hex-5-enethioamide?
The canonical SMILES for hex-5-enethioamide is C=CCCCC(N)=S.
What is the InChIKey of hex-5-enethioamide?
The InChIKey is BHEZSCZLWDURSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NS/c1-2-3-4-5-6(7)8/h2H,1,3-5H2,(H2,7,8).
What are the key properties of hex-5-enethioamide?
hex-5-enethioamide has a molecular weight of 129.23 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-enethioamide is sourced from PubChem (CID 88640967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).