About 12-aminododec-1-en-6-one
12-aminododec-1-en-6-one (PubChem CID 116551538) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 12-aminododec-1-en-6-one.
Molecular Properties
| Compound Name | 12-aminododec-1-en-6-one |
| PubChem CID | 116551538 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 12-aminododec-1-en-6-one |
| SMILES | C=CCCCC(=O)CCCCCCN |
| InChI | InChI=1S/C12H23NO/c1-2-3-6-9-12(14)10-7-4-5-8-11-13/h2H,1,3-11,13H2 |
| InChIKey | OATUKXAONPGKJT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 12-aminododec-1-en-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-aminododec-1-en-6-one?
The IUPAC name of 12-aminododec-1-en-6-one (CID 116551538) is 12-aminododec-1-en-6-one.
What is the SMILES notation for 12-aminododec-1-en-6-one?
The canonical SMILES for 12-aminododec-1-en-6-one is C=CCCCC(=O)CCCCCCN.
What is the InChIKey of 12-aminododec-1-en-6-one?
The InChIKey is OATUKXAONPGKJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-2-3-6-9-12(14)10-7-4-5-8-11-13/h2H,1,3-11,13H2.
What are the key properties of 12-aminododec-1-en-6-one?
12-aminododec-1-en-6-one has a molecular weight of 197.32 g/mol, XLogP of 2.82, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-aminododec-1-en-6-one is sourced from PubChem (CID 116551538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).