About methyl undec-10-enedithioate
methyl undec-10-enedithioate (PubChem CID 134988678) has the molecular formula C12H22S2
and a molecular weight of 230.44 g/mol. Its IUPAC name is methyl undec-10-enedithioate.
Molecular Properties
| Compound Name | methyl undec-10-enedithioate |
| PubChem CID | 134988678 |
| Molecular Formula | C12H22S2 |
| Molecular Weight | 230.44 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | methyl undec-10-enedithioate |
| SMILES | C=CCCCCCCCCC(=S)SC |
| InChI | InChI=1S/C12H22S2/c1-3-4-5-6-7-8-9-10-11-12(13)14-2/h3H,1,4-11H2,2H3 |
| InChIKey | RFKVTHBQWPLXOW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl undec-10-enedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl undec-10-enedithioate?
The IUPAC name of methyl undec-10-enedithioate (CID 134988678) is methyl undec-10-enedithioate.
What is the SMILES notation for methyl undec-10-enedithioate?
The canonical SMILES for methyl undec-10-enedithioate is C=CCCCCCCCCC(=S)SC.
What is the InChIKey of methyl undec-10-enedithioate?
The InChIKey is RFKVTHBQWPLXOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22S2/c1-3-4-5-6-7-8-9-10-11-12(13)14-2/h3H,1,4-11H2,2H3.
What are the key properties of methyl undec-10-enedithioate?
methyl undec-10-enedithioate has a molecular weight of 230.44 g/mol, XLogP of 4.98, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl undec-10-enedithioate is sourced from PubChem (CID 134988678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).