About O-silyl hept-6-enethioate
O-silyl hept-6-enethioate (PubChem CID 154086221) has the molecular formula C7H14OSSi
and a molecular weight of 174.34 g/mol. Its IUPAC name is O-silyl hept-6-enethioate.
Molecular Properties
| Compound Name | O-silyl hept-6-enethioate |
| PubChem CID | 154086221 |
| Molecular Formula | C7H14OSSi |
| Molecular Weight | 174.34 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | O-silyl hept-6-enethioate |
| SMILES | C=CCCCCC(=S)O[SiH3] |
| InChI | InChI=1S/C7H14OSSi/c1-2-3-4-5-6-7(9)8-10/h2H,1,3-6H2,10H3 |
| InChIKey | CJDZKJIOAYLALA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-silyl hept-6-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-silyl hept-6-enethioate?
The IUPAC name of O-silyl hept-6-enethioate (CID 154086221) is O-silyl hept-6-enethioate.
What is the SMILES notation for O-silyl hept-6-enethioate?
The canonical SMILES for O-silyl hept-6-enethioate is C=CCCCCC(=S)O[SiH3].
What is the InChIKey of O-silyl hept-6-enethioate?
The InChIKey is CJDZKJIOAYLALA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14OSSi/c1-2-3-4-5-6-7(9)8-10/h2H,1,3-6H2,10H3.
What are the key properties of O-silyl hept-6-enethioate?
O-silyl hept-6-enethioate has a molecular weight of 174.34 g/mol, XLogP of 1.36, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-silyl hept-6-enethioate is sourced from PubChem (CID 154086221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).