C9H18FN — CID 162360697
ethane;N-fluoro-N-methylhexa-1,5-dien-2-amine (PubChem CID 162360697) has the molecular formula C9H18FN and a molecular weight of 159.25 g/mol. Its IUPAC name is ethane;N-fluoro-N-methylhexa-1,5-dien-2-amine.
| Compound Name | ethane;N-fluoro-N-methylhexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 162360697 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | ethane;N-fluoro-N-methylhexa-1,5-dien-2-amine |
| SMILES | C=CCCC(=C)N(C)F.CC |
| InChI | InChI=1S/C7H12FN.C2H6/c1-4-5-6-7(2)9(3)8;1-2/h4H,1-2,5-6H2,3H3;1-2H3 |
| InChIKey | YVKWPMFINWDPJG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|