About ethane;5-methylideneoct-1-ene;2-methylprop-1-ene
ethane;5-methylideneoct-1-ene;2-methylprop-1-ene (PubChem CID 142462861) has the molecular formula C19H42
and a molecular weight of 270.54 g/mol. Its IUPAC name is ethane;5-methylideneoct-1-ene;2-methylprop-1-ene.
Molecular Properties
| Compound Name | ethane;5-methylideneoct-1-ene;2-methylprop-1-ene |
| PubChem CID | 142462861 |
| Molecular Formula | C19H42 |
| Molecular Weight | 270.54 g/mol |
| Exact Mass | 270.33 |
| IUPAC Name | ethane;5-methylideneoct-1-ene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CCCC(=C)CCC.CC.CC.CC |
| InChI | InChI=1S/C9H16.C4H8.3C2H6/c1-4-6-8-9(3)7-5-2;1-4(2)3;3*1-2/h4H,1,3,5-8H2,2H3;1H2,2-3H3;3*1-2H3 |
| InChIKey | CHPIJJUXEWTWEL-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.54 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methylideneoct-1-ene;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylideneoct-1-ene;2-methylprop-1-ene?
The IUPAC name of ethane;5-methylideneoct-1-ene;2-methylprop-1-ene (CID 142462861) is ethane;5-methylideneoct-1-ene;2-methylprop-1-ene.
What is the SMILES notation for ethane;5-methylideneoct-1-ene;2-methylprop-1-ene?
The canonical SMILES for ethane;5-methylideneoct-1-ene;2-methylprop-1-ene is C=C(C)C.C=CCCC(=C)CCC.CC.CC.CC.
What is the InChIKey of ethane;5-methylideneoct-1-ene;2-methylprop-1-ene?
The InChIKey is CHPIJJUXEWTWEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16.C4H8.3C2H6/c1-4-6-8-9(3)7-5-2;1-4(2)3;3*1-2/h4H,1,3,5-8H2,2H3;1H2,2-3H3;3*1-2H3.
What are the key properties of ethane;5-methylideneoct-1-ene;2-methylprop-1-ene?
ethane;5-methylideneoct-1-ene;2-methylprop-1-ene has a molecular weight of 270.54 g/mol, XLogP of 7.97, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylideneoct-1-ene;2-methylprop-1-ene is sourced from PubChem (CID 142462861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).