C12H25N — CID 90787138
N,4-dimethyl-N-(2-methylbutyl)pent-1-en-2-amine (PubChem CID 90787138) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is N,4-dimethyl-N-(2-methylbutyl)pent-1-en-2-amine.
| Compound Name | N,4-dimethyl-N-(2-methylbutyl)pent-1-en-2-amine |
|---|---|
| PubChem CID | 90787138 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | N,4-dimethyl-N-(2-methylbutyl)pent-1-en-2-amine |
| SMILES | C=C(CC(C)C)N(C)CC(C)CC |
| InChI | InChI=1S/C12H25N/c1-7-11(4)9-13(6)12(5)8-10(2)3/h10-11H,5,7-9H2,1-4,6H3 |
| InChIKey | PVTDGIZTLZFXTP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |