C15H26 — CID 155779414
(7Z)-9-ethyl-6-methylidenedodeca-1,7-diene (PubChem CID 155779414) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (7Z)-9-ethyl-6-methylidenedodeca-1,7-diene.
| Compound Name | (7Z)-9-ethyl-6-methylidenedodeca-1,7-diene |
|---|---|
| PubChem CID | 155779414 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (7Z)-9-ethyl-6-methylidenedodeca-1,7-diene |
| SMILES | C=CCCCC(=C)/C=C\C(CC)CCC |
| InChI | InChI=1S/C15H26/c1-5-8-9-11-14(4)12-13-15(7-3)10-6-2/h5,12-13,15H,1,4,6-11H2,2-3H3/b13-12- |
| InChIKey | XJYVHANFMXBTGO-SEYXRHQNSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|