C13H24O — CID 87447746
6-(3-methylbutoxy)octa-1,6-diene (PubChem CID 87447746) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is 6-(3-methylbutoxy)octa-1,6-diene.
| Compound Name | 6-(3-methylbutoxy)octa-1,6-diene |
|---|---|
| PubChem CID | 87447746 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 6-(3-methylbutoxy)octa-1,6-diene |
| SMILES | C=CCCCC(=CC)OCCC(C)C |
| InChI | InChI=1S/C13H24O/c1-5-7-8-9-13(6-2)14-11-10-12(3)4/h5-6,12H,1,7-11H2,2-4H3 |
| InChIKey | ZWSMPAUHEGTZLO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|