About 10-aminoundec-1-en-6-one
10-aminoundec-1-en-6-one (PubChem CID 116610182) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 10-aminoundec-1-en-6-one.
Molecular Properties
| Compound Name | 10-aminoundec-1-en-6-one |
| PubChem CID | 116610182 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 10-aminoundec-1-en-6-one |
| SMILES | C=CCCCC(=O)CCCC(C)N |
| InChI | InChI=1S/C11H21NO/c1-3-4-5-8-11(13)9-6-7-10(2)12/h3,10H,1,4-9,12H2,2H3 |
| InChIKey | SPWQQMYPQUUEDA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-aminoundec-1-en-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-aminoundec-1-en-6-one?
The IUPAC name of 10-aminoundec-1-en-6-one (CID 116610182) is 10-aminoundec-1-en-6-one.
What is the SMILES notation for 10-aminoundec-1-en-6-one?
The canonical SMILES for 10-aminoundec-1-en-6-one is C=CCCCC(=O)CCCC(C)N.
What is the InChIKey of 10-aminoundec-1-en-6-one?
The InChIKey is SPWQQMYPQUUEDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-3-4-5-8-11(13)9-6-7-10(2)12/h3,10H,1,4-9,12H2,2H3.
What are the key properties of 10-aminoundec-1-en-6-one?
10-aminoundec-1-en-6-one has a molecular weight of 183.29 g/mol, XLogP of 2.43, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-aminoundec-1-en-6-one is sourced from PubChem (CID 116610182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).