C19H26O4 — CID 91719910
2-O-(4-methylpentyl) 1-O-pent-4-enyl benzene-1,2-dicarboxylate (PubChem CID 91719910) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-O-(4-methylpentyl) 1-O-pent-4-enyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(4-methylpentyl) 1-O-pent-4-enyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91719910 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-O-(4-methylpentyl) 1-O-pent-4-enyl benzene-1,2-dicarboxylate |
| SMILES | C=CCCCOC(=O)c1ccccc1C(=O)OCCCC(C)C |
| InChI | InChI=1S/C19H26O4/c1-4-5-8-13-22-18(20)16-11-6-7-12-17(16)19(21)23-14-9-10-15(2)3/h4,6-7,11-12,15H,1,5,8-10,13-14H2,2-3H3 |
| InChIKey | VBRGOLZLSZHHGU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|