C20H30O8 — CID 67200284
bis(4,4-dimethoxybutyl) benzene-1,2-dicarboxylate (PubChem CID 67200284) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is bis(4,4-dimethoxybutyl) benzene-1,2-dicarboxylate.
| Compound Name | bis(4,4-dimethoxybutyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67200284 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | bis(4,4-dimethoxybutyl) benzene-1,2-dicarboxylate |
| SMILES | COC(CCCOC(=O)c1ccccc1C(=O)OCCCC(OC)OC)OC |
| InChI | InChI=1S/C20H30O8/c1-23-17(24-2)11-7-13-27-19(21)15-9-5-6-10-16(15)20(22)28-14-8-12-18(25-3)26-4/h5-6,9-10,17-18H,7-8,11-14H2,1-4H3 |
| InChIKey | XZNZPRQPYWRHML-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|