C29H37F3O2 — CID 143772897
(3Z,7Z,11E)-2-(but-3-enoxymethyl)-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-15-propan-2-yloxypentadeca-1,3,7,11-tetraene (PubChem CID 143772897) has the molecular formula C29H37F3O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is (3Z,7Z,11E)-2-(but-3-enoxymethyl)-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-15-propan-2-yloxypentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11E)-2-(but-3-enoxymethyl)-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-15-propan-2-yloxypentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143772897 |
| Molecular Formula | C29H37F3O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | (3Z,7Z,11E)-2-(but-3-enoxymethyl)-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-15-propan-2-yloxypentadeca-1,3,7,11-tetraene |
| SMILES | C=CCCOCC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C/C(=C)C(=C)/C=C(/F)C(=C)C(C)COC(C)C |
| InChI | InChI=1S/C29H37F3O2/c1-11-12-15-33-17-24(8)28(31)29(32)26(10)21(5)14-13-20(4)22(6)16-27(30)25(9)23(7)18-34-19(2)3/h11,13-14,16,19,23H,1,4-6,8-10,12,15,17-18H2,2-3,7H3/b14-13-,27-16+,29-28- |
| InChIKey | FAXQDBOJZHYOPL-FAZPXKEJSA-N |
| XLogP | 8.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|