C18H33N — CID 144845833
(3E,5Z)-3,5-dimethyl-N-(4-methylpentyl)-N-propylhepta-1,3,5-trien-4-amine (PubChem CID 144845833) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is (3E,5Z)-3,5-dimethyl-N-(4-methylpentyl)-N-propylhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-3,5-dimethyl-N-(4-methylpentyl)-N-propylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 144845833 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | (3E,5Z)-3,5-dimethyl-N-(4-methylpentyl)-N-propylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C(C)=C(C(\C)=C/C)/N(CCC)CCCC(C)C |
| InChI | InChI=1S/C18H33N/c1-8-13-19(14-11-12-15(4)5)18(16(6)9-2)17(7)10-3/h9-10,15H,2,8,11-14H2,1,3-7H3/b17-10-,18-16+ |
| InChIKey | QEYFRYBNAXBXOI-UTTXNCOQSA-N |
| XLogP | 5.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|