C12H17F3 — CID 145113868
(3E,5E,7E)-3-methyl-5-(trifluoromethyl)deca-3,5,7-triene (PubChem CID 145113868) has the molecular formula C12H17F3 and a molecular weight of 218.26 g/mol. Its IUPAC name is (3E,5E,7E)-3-methyl-5-(trifluoromethyl)deca-3,5,7-triene.
| Compound Name | (3E,5E,7E)-3-methyl-5-(trifluoromethyl)deca-3,5,7-triene |
|---|---|
| PubChem CID | 145113868 |
| Molecular Formula | C12H17F3 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (3E,5E,7E)-3-methyl-5-(trifluoromethyl)deca-3,5,7-triene |
| SMILES | CC/C=C/C=C(\C=C(/C)CC)C(F)(F)F |
| InChI | InChI=1S/C12H17F3/c1-4-6-7-8-11(12(13,14)15)9-10(3)5-2/h6-9H,4-5H2,1-3H3/b7-6+,10-9+,11-8+ |
| InChIKey | CZWTXGWRBNXIDB-QXMRGVDISA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|