C10H20N2 — CID 143508442
N-methyl-N'-[(2E,4Z)-2-methylhexa-2,4-dienyl]ethane-1,2-diamine (PubChem CID 143508442) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N-methyl-N'-[(2E,4Z)-2-methylhexa-2,4-dienyl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[(2E,4Z)-2-methylhexa-2,4-dienyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 143508442 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N-methyl-N'-[(2E,4Z)-2-methylhexa-2,4-dienyl]ethane-1,2-diamine |
| SMILES | C/C=C\C=C(/C)CNCCNC |
| InChI | InChI=1S/C10H20N2/c1-4-5-6-10(2)9-12-8-7-11-3/h4-6,11-12H,7-9H2,1-3H3/b5-4-,10-6+ |
| InChIKey | VWUWQGZFIGICCC-VWJYOPCBSA-N |
| XLogP | 1.32 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|