C18H38N4 — CID 143942317
(2E,4E)-N,N'-bis(3-amino-3-methylbutyl)-2,5-dimethylhexa-2,4-diene-1,6-diamine (PubChem CID 143942317) has the molecular formula C18H38N4 and a molecular weight of 310.53 g/mol. Its IUPAC name is (2E,4E)-N,N'-bis(3-amino-3-methylbutyl)-2,5-dimethylhexa-2,4-diene-1,6-diamine.
| Compound Name | (2E,4E)-N,N'-bis(3-amino-3-methylbutyl)-2,5-dimethylhexa-2,4-diene-1,6-diamine |
|---|---|
| PubChem CID | 143942317 |
| Molecular Formula | C18H38N4 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.31 |
| IUPAC Name | (2E,4E)-N,N'-bis(3-amino-3-methylbutyl)-2,5-dimethylhexa-2,4-diene-1,6-diamine |
| SMILES | C/C(=C\C=C(/C)CNCCC(C)(C)N)CNCCC(C)(C)N |
| InChI | InChI=1S/C18H38N4/c1-15(13-21-11-9-17(3,4)19)7-8-16(2)14-22-12-10-18(5,6)20/h7-8,21-22H,9-14,19-20H2,1-6H3/b15-7+,16-8+ |
| InChIKey | USHWJVIMKMAJIL-BGPOSVGRSA-N |
| XLogP | 2.31 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|