C13H20O — CID 15331553
(2E,8E,10E)-2-methyldodeca-2,8,10-trienal (PubChem CID 15331553) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (2E,8E,10E)-2-methyldodeca-2,8,10-trienal.
| Compound Name | (2E,8E,10E)-2-methyldodeca-2,8,10-trienal |
|---|---|
| PubChem CID | 15331553 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (2E,8E,10E)-2-methyldodeca-2,8,10-trienal |
| SMILES | C/C=C/C=C/CCCC/C=C(\C)C=O |
| InChI | InChI=1S/C13H20O/c1-3-4-5-6-7-8-9-10-11-13(2)12-14/h3-6,11-12H,7-10H2,1-2H3/b4-3+,6-5+,13-11+ |
| InChIKey | PVVBBVYBYNBGJD-NCOIUYIOSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|