C7H13N3 — CID 143488080
N'-[1-[ethyl(methyl)amino]ethenyl]-N-methylidenemethanimidamide (PubChem CID 143488080) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is N'-[1-[ethyl(methyl)amino]ethenyl]-N-methylidenemethanimidamide.
| Compound Name | N'-[1-[ethyl(methyl)amino]ethenyl]-N-methylidenemethanimidamide |
|---|---|
| PubChem CID | 143488080 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N'-[1-[ethyl(methyl)amino]ethenyl]-N-methylidenemethanimidamide |
| SMILES | C=N/C=N\C(=C)N(C)CC |
| InChI | InChI=1S/C7H13N3/c1-5-10(4)7(2)9-6-8-3/h6H,2-3,5H2,1,4H3/b9-6- |
| InChIKey | FGMPLRWRUPBKFJ-TWGQIWQCSA-N |
| XLogP | 1.14 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|