C15H26N2 — CID 176966687
(3Z,4E)-N,4-diethyl-N-methyl-3-[(propan-2-ylideneamino)methylidene]hexa-1,4-dien-2-amine (PubChem CID 176966687) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (3Z,4E)-N,4-diethyl-N-methyl-3-[(propan-2-ylideneamino)methylidene]hexa-1,4-dien-2-amine.
| Compound Name | (3Z,4E)-N,4-diethyl-N-methyl-3-[(propan-2-ylideneamino)methylidene]hexa-1,4-dien-2-amine |
|---|---|
| PubChem CID | 176966687 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (3Z,4E)-N,4-diethyl-N-methyl-3-[(propan-2-ylideneamino)methylidene]hexa-1,4-dien-2-amine |
| SMILES | C=C(C(=C\N=C(C)C)/C(=C/C)CC)N(C)CC |
| InChI | InChI=1S/C15H26N2/c1-8-14(9-2)15(11-16-12(4)5)13(6)17(7)10-3/h8,11H,6,9-10H2,1-5,7H3/b14-8+,15-11+ |
| InChIKey | JBMIUTAJAPQUFW-FVXNJELISA-N |
| XLogP | 4.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|