C11H21N — CID 131995831
(3Z)-N-ethyl-N,3-dimethylhepta-1,3-dien-2-amine (PubChem CID 131995831) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (3Z)-N-ethyl-N,3-dimethylhepta-1,3-dien-2-amine.
| Compound Name | (3Z)-N-ethyl-N,3-dimethylhepta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 131995831 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (3Z)-N-ethyl-N,3-dimethylhepta-1,3-dien-2-amine |
| SMILES | C=C(/C(C)=C\CCC)N(C)CC |
| InChI | InChI=1S/C11H21N/c1-6-8-9-10(3)11(4)12(5)7-2/h9H,4,6-8H2,1-3,5H3/b10-9- |
| InChIKey | JEVZGVPDYWZXPT-KTKRTIGZSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|