C11H21N — CID 163733373
(6Z)-N-ethyl-N-methylocta-1,6-dien-2-amine (PubChem CID 163733373) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (6Z)-N-ethyl-N-methylocta-1,6-dien-2-amine.
| Compound Name | (6Z)-N-ethyl-N-methylocta-1,6-dien-2-amine |
|---|---|
| PubChem CID | 163733373 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (6Z)-N-ethyl-N-methylocta-1,6-dien-2-amine |
| SMILES | C=C(CCC/C=C\C)N(C)CC |
| InChI | InChI=1S/C11H21N/c1-5-7-8-9-10-11(3)12(4)6-2/h5,7H,3,6,8-10H2,1-2,4H3/b7-5- |
| InChIKey | LBNKUOZVODZGCK-ALCCZGGFSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|