C24H43N2+ — CID 118120033
[(4Z,7Z)-9-(diethylamino)-5-[(E)-hex-2-en-2-yl]deca-4,7,9-trienylidene]-diethylazanium (PubChem CID 118120033) has the molecular formula C24H43N2+ and a molecular weight of 359.62 g/mol. Its IUPAC name is [(4Z,7Z)-9-(diethylamino)-5-[(E)-hex-2-en-2-yl]deca-4,7,9-trienylidene]-diethylazanium.
| Compound Name | [(4Z,7Z)-9-(diethylamino)-5-[(E)-hex-2-en-2-yl]deca-4,7,9-trienylidene]-diethylazanium |
|---|---|
| PubChem CID | 118120033 |
| Molecular Formula | C24H43N2+ |
| Molecular Weight | 359.62 g/mol |
| Exact Mass | 359.34 |
| IUPAC Name | [(4Z,7Z)-9-(diethylamino)-5-[(E)-hex-2-en-2-yl]deca-4,7,9-trienylidene]-diethylazanium |
| SMILES | C=C(/C=C\CC(=C/CCC=[N+](CC)CC)/C(C)=C/CCC)N(CC)CC |
| InChI | InChI=1S/C24H43N2/c1-8-13-17-22(6)24(19-14-15-21-25(9-2)10-3)20-16-18-23(7)26(11-4)12-5/h16-19,21H,7-15,20H2,1-6H3/q+1/b18-16-,22-17+,24-19- |
| InChIKey | QGKZNHOQRLLFIC-JFJMFPNKSA-N |
| XLogP | 6.36 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|