C7H12BrN — CID 166982153
(3E)-5-bromo-N,N-dimethylpenta-1,3-dien-2-amine (PubChem CID 166982153) has the molecular formula C7H12BrN and a molecular weight of 190.08 g/mol. Its IUPAC name is (3E)-5-bromo-N,N-dimethylpenta-1,3-dien-2-amine.
| Compound Name | (3E)-5-bromo-N,N-dimethylpenta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 166982153 |
| Molecular Formula | C7H12BrN |
| Molecular Weight | 190.08 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | (3E)-5-bromo-N,N-dimethylpenta-1,3-dien-2-amine |
| SMILES | C=C(/C=C/CBr)N(C)C |
| InChI | InChI=1S/C7H12BrN/c1-7(9(2)3)5-4-6-8/h4-5H,1,6H2,2-3H3/b5-4+ |
| InChIKey | ZFSNJYZZBJOLKQ-SNAWJCMRSA-N |
| XLogP | 2.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.08 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|