C14H26NP — CID 144813242
(3Z)-5-[tert-butyl(ethyl)phosphanyl]-N,N-dimethylhexa-1,3,5-trien-2-amine (PubChem CID 144813242) has the molecular formula C14H26NP and a molecular weight of 239.34 g/mol. Its IUPAC name is (3Z)-5-[tert-butyl(ethyl)phosphanyl]-N,N-dimethylhexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-5-[tert-butyl(ethyl)phosphanyl]-N,N-dimethylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 144813242 |
| Molecular Formula | C14H26NP |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | (3Z)-5-[tert-butyl(ethyl)phosphanyl]-N,N-dimethylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C)P(CC)C(C)(C)C)N(C)C |
| InChI | InChI=1S/C14H26NP/c1-9-16(14(4,5)6)13(3)11-10-12(2)15(7)8/h10-11H,2-3,9H2,1,4-8H3/b11-10- |
| InChIKey | ABPNLLTYFKBFMF-KHPPLWFESA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|