C9H16N2 — CID 134313131
(3Z,5E)-2-N,2-N-dimethylhepta-1,3,5-triene-2,5-diamine (PubChem CID 134313131) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (3Z,5E)-2-N,2-N-dimethylhepta-1,3,5-triene-2,5-diamine.
| Compound Name | (3Z,5E)-2-N,2-N-dimethylhepta-1,3,5-triene-2,5-diamine |
|---|---|
| PubChem CID | 134313131 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3Z,5E)-2-N,2-N-dimethylhepta-1,3,5-triene-2,5-diamine |
| SMILES | C=C(/C=C\C(N)=C/C)N(C)C |
| InChI | InChI=1S/C9H16N2/c1-5-9(10)7-6-8(2)11(3)4/h5-7H,2,10H2,1,3-4H3/b7-6-,9-5+ |
| InChIKey | ZCAPBKGHLMBDDW-QRLJIZSYSA-N |
| XLogP | 1.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|