C10H15NO2 — CID 89180128
ethyl (3Z,5E)-5-amino-2-methylidenehepta-3,5-dienoate (PubChem CID 89180128) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is ethyl (3Z,5E)-5-amino-2-methylidenehepta-3,5-dienoate.
| Compound Name | ethyl (3Z,5E)-5-amino-2-methylidenehepta-3,5-dienoate |
|---|---|
| PubChem CID | 89180128 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | ethyl (3Z,5E)-5-amino-2-methylidenehepta-3,5-dienoate |
| SMILES | C=C(/C=C\C(N)=C/C)C(=O)OCC |
| InChI | InChI=1S/C10H15NO2/c1-4-9(11)7-6-8(3)10(12)13-5-2/h4,6-7H,3,5,11H2,1-2H3/b7-6-,9-4+ |
| InChIKey | GVJOPEALPCOFEG-WSISTYIOSA-N |
| XLogP | 1.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|