About acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate
acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate (PubChem CID 143740960) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate.
Molecular Properties
| Compound Name | acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate |
| PubChem CID | 143740960 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate |
| SMILES | C#C.C=C(/C=C(/C)N(C)CC)C(=O)OCC |
| InChI | InChI=1S/C11H19NO2.C2H2/c1-6-12(5)10(4)8-9(3)11(13)14-7-2;1-2/h8H,3,6-7H2,1-2,4-5H3;1-2H/b10-8-; |
| InChIKey | CRZCMTDPGRHFTL-DQMXGCRQSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate?
The IUPAC name of acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate (CID 143740960) is acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate.
What is the SMILES notation for acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate?
The canonical SMILES for acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate is C#C.C=C(/C=C(/C)N(C)CC)C(=O)OCC.
What is the InChIKey of acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate?
The InChIKey is CRZCMTDPGRHFTL-DQMXGCRQSA-N. The full InChI is InChI=1S/C11H19NO2.C2H2/c1-6-12(5)10(4)8-9(3)11(13)14-7-2;1-2/h8H,3,6-7H2,1-2,4-5H3;1-2H/b10-8-;.
What are the key properties of acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate?
acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate has a molecular weight of 223.32 g/mol, XLogP of 2.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;ethyl (Z)-4-[ethyl(methyl)amino]-2-methylidenepent-3-enoate is sourced from PubChem (CID 143740960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).