C9H14N2O2 — CID 143114007
ethyl (3Z)-5-hydrazinyl-2-methylidenehexa-3,5-dienoate (PubChem CID 143114007) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is ethyl (3Z)-5-hydrazinyl-2-methylidenehexa-3,5-dienoate.
| Compound Name | ethyl (3Z)-5-hydrazinyl-2-methylidenehexa-3,5-dienoate |
|---|---|
| PubChem CID | 143114007 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | ethyl (3Z)-5-hydrazinyl-2-methylidenehexa-3,5-dienoate |
| SMILES | C=C(/C=C\C(=C)C(=O)OCC)NN |
| InChI | InChI=1S/C9H14N2O2/c1-4-13-9(12)7(2)5-6-8(3)11-10/h5-6,11H,2-4,10H2,1H3/b6-5- |
| InChIKey | BVQYCWIETBOUBU-WAYWQWQTSA-N |
| XLogP | 0.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|