C13H25N3O2 — CID 70521869
1,4-diazabicyclo[2.2.0]hexane;ethyl 3-[ethyl(methyl)amino]but-2-enoate (PubChem CID 70521869) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.0]hexane;ethyl 3-[ethyl(methyl)amino]but-2-enoate.
| Compound Name | 1,4-diazabicyclo[2.2.0]hexane;ethyl 3-[ethyl(methyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 70521869 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 1,4-diazabicyclo[2.2.0]hexane;ethyl 3-[ethyl(methyl)amino]but-2-enoate |
| SMILES | C1CN2CCN12.CCOC(=O)C=C(C)N(C)CC |
| InChI | InChI=1S/C9H17NO2.C4H8N2/c1-5-10(4)8(3)7-9(11)12-6-2;1-2-6-4-3-5(1)6/h7H,5-6H2,1-4H3;1-4H2 |
| InChIKey | IAHVQASERRERTG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|