C6H10INO — CID 11843066
2-(iodomethyl)-N,N-dimethylprop-2-enamide (PubChem CID 11843066) has the molecular formula C6H10INO and a molecular weight of 239.06 g/mol. Its IUPAC name is 2-(iodomethyl)-N,N-dimethylprop-2-enamide.
| Compound Name | 2-(iodomethyl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 11843066 |
| Molecular Formula | C6H10INO |
| Molecular Weight | 239.06 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | 2-(iodomethyl)-N,N-dimethylprop-2-enamide |
| SMILES | C=C(CI)C(=O)N(C)C |
| InChI | InChI=1S/C6H10INO/c1-5(4-7)6(9)8(2)3/h1,4H2,2-3H3 |
| InChIKey | OZCMOMCIPRYZOJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.06 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|