C8H15NO3 — CID 20770092
2-(methoxymethoxymethyl)-N,N-dimethylprop-2-enamide (PubChem CID 20770092) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-(methoxymethoxymethyl)-N,N-dimethylprop-2-enamide.
| Compound Name | 2-(methoxymethoxymethyl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 20770092 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-(methoxymethoxymethyl)-N,N-dimethylprop-2-enamide |
| SMILES | C=C(COCOC)C(=O)N(C)C |
| InChI | InChI=1S/C8H15NO3/c1-7(5-12-6-11-4)8(10)9(2)3/h1,5-6H2,2-4H3 |
| InChIKey | GOGYFKGOEGASIU-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|