C8H12FNO — CID 118667310
(NE)-N-[(4Z,6E)-6-fluoroocta-4,6-dien-3-ylidene]hydroxylamine (PubChem CID 118667310) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is (NE)-N-[(4Z,6E)-6-fluoroocta-4,6-dien-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4Z,6E)-6-fluoroocta-4,6-dien-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 118667310 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (NE)-N-[(4Z,6E)-6-fluoroocta-4,6-dien-3-ylidene]hydroxylamine |
| SMILES | C/C=C(F)\C=C/C(CC)=N/O |
| InChI | InChI=1S/C8H12FNO/c1-3-7(9)5-6-8(4-2)10-11/h3,5-6,11H,4H2,1-2H3/b6-5-,7-3+,10-8+ |
| InChIKey | PNGPULNLUPEGNW-RPRLLXEXSA-N |
| XLogP | 2.66 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|