C8H13N2O+ — CID 143189899
[(1Z,3Z)-1-cyanohexa-1,3-dienyl]-methoxyazanium (PubChem CID 143189899) has the molecular formula C8H13N2O+ and a molecular weight of 153.20 g/mol. Its IUPAC name is [(1Z,3Z)-1-cyanohexa-1,3-dienyl]-methoxyazanium.
| Compound Name | [(1Z,3Z)-1-cyanohexa-1,3-dienyl]-methoxyazanium |
|---|---|
| PubChem CID | 143189899 |
| Molecular Formula | C8H13N2O+ |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | [(1Z,3Z)-1-cyanohexa-1,3-dienyl]-methoxyazanium |
| SMILES | CC/C=C\C=C(\C#N)[NH2+]OC |
| InChI | InChI=1S/C8H12N2O/c1-3-4-5-6-8(7-9)10-11-2/h4-6,10H,3H2,1-2H3/p+1/b5-4-,8-6- |
| InChIKey | HNSDFMSDFDXXNN-NADLECRISA-O |
| XLogP | 0.48 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|