C11H13NO3S — CID 58422539
4-(3-methyl-2-oxobut-3-enyl)benzenesulfonamide (PubChem CID 58422539) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 4-(3-methyl-2-oxobut-3-enyl)benzenesulfonamide.
| Compound Name | 4-(3-methyl-2-oxobut-3-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58422539 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 4-(3-methyl-2-oxobut-3-enyl)benzenesulfonamide |
| SMILES | C=C(C)C(=O)Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H13NO3S/c1-8(2)11(13)7-9-3-5-10(6-4-9)16(12,14)15/h3-6H,1,7H2,2H3,(H2,12,14,15) |
| InChIKey | LTVYMRYTLXXMBR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|