C15H23N3O4S — CID 95750555
4-[2-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]-2-oxoethyl]benzenesulfonamide (PubChem CID 95750555) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-[2-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | 4-[2-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95750555 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-[2-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]-2-oxoethyl]benzenesulfonamide |
| SMILES | C[C@H](O)CN1CCN(C(=O)Cc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C15H23N3O4S/c1-12(19)11-17-6-8-18(9-7-17)15(20)10-13-2-4-14(5-3-13)23(16,21)22/h2-5,12,19H,6-11H2,1H3,(H2,16,21,22)/t12-/m0/s1 |
| InChIKey | LDXAETCWEAWOTF-LBPRGKRZSA-N |
| XLogP | -0.60 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |