C11H13N3O4S — CID 79674690
4-(3-amino-4-hydroxyphenyl)sulfonylmorpholine-2-carbonitrile (PubChem CID 79674690) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 4-(3-amino-4-hydroxyphenyl)sulfonylmorpholine-2-carbonitrile.
| Compound Name | 4-(3-amino-4-hydroxyphenyl)sulfonylmorpholine-2-carbonitrile |
|---|---|
| PubChem CID | 79674690 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-(3-amino-4-hydroxyphenyl)sulfonylmorpholine-2-carbonitrile |
| SMILES | N#CC1CN(S(=O)(=O)c2ccc(O)c(N)c2)CCO1 |
| InChI | InChI=1S/C11H13N3O4S/c12-6-8-7-14(3-4-18-8)19(16,17)9-1-2-11(15)10(13)5-9/h1-2,5,8,15H,3-4,7,13H2 |
| InChIKey | IEQRVAQUIVKHDB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|