C11H10ClF3N2O3S — CID 114490490
3-chloro-5-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-1H-pyridin-2-one (PubChem CID 114490490) has the molecular formula C11H10ClF3N2O3S and a molecular weight of 342.73 g/mol. Its IUPAC name is 3-chloro-5-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-1H-pyridin-2-one.
| Compound Name | 3-chloro-5-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 114490490 |
| Molecular Formula | C11H10ClF3N2O3S |
| Molecular Weight | 342.73 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 3-chloro-5-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(S(=O)(=O)N2CC=C(C(F)(F)F)CC2)cc1Cl |
| InChI | InChI=1S/C11H10ClF3N2O3S/c12-9-5-8(6-16-10(9)18)21(19,20)17-3-1-7(2-4-17)11(13,14)15/h1,5-6H,2-4H2,(H,16,18) |
| InChIKey | ZYFPXDJLVJWRQT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.73 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|