C11H15ClN2O3S2 — CID 64608490
3-chloro-5-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-1H-pyridin-2-one (PubChem CID 64608490) has the molecular formula C11H15ClN2O3S2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 3-chloro-5-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-1H-pyridin-2-one.
| Compound Name | 3-chloro-5-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 64608490 |
| Molecular Formula | C11H15ClN2O3S2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 3-chloro-5-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-1H-pyridin-2-one |
| SMILES | CC1CN(S(=O)(=O)c2c[nH]c(=O)c(Cl)c2)CC(C)S1 |
| InChI | InChI=1S/C11H15ClN2O3S2/c1-7-5-14(6-8(2)18-7)19(16,17)9-3-10(12)11(15)13-4-9/h3-4,7-8H,5-6H2,1-2H3,(H,13,15) |
| InChIKey | FTMJFSZPQCCDLM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |