C11H12ClF3N2O3S — CID 64608278
3-chloro-5-[3-(trifluoromethyl)piperidin-1-yl]sulfonyl-1H-pyridin-2-one (PubChem CID 64608278) has the molecular formula C11H12ClF3N2O3S and a molecular weight of 344.74 g/mol. Its IUPAC name is 3-chloro-5-[3-(trifluoromethyl)piperidin-1-yl]sulfonyl-1H-pyridin-2-one.
| Compound Name | 3-chloro-5-[3-(trifluoromethyl)piperidin-1-yl]sulfonyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 64608278 |
| Molecular Formula | C11H12ClF3N2O3S |
| Molecular Weight | 344.74 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 3-chloro-5-[3-(trifluoromethyl)piperidin-1-yl]sulfonyl-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(S(=O)(=O)N2CCCC(C(F)(F)F)C2)cc1Cl |
| InChI | InChI=1S/C11H12ClF3N2O3S/c12-9-4-8(5-16-10(9)18)21(19,20)17-3-1-2-7(6-17)11(13,14)15/h4-5,7H,1-3,6H2,(H,16,18) |
| InChIKey | VSOVECPDAZYASN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.74 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |