C10H12ClN3O4S — CID 64608248
1-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonyl]pyrrolidine-2-carboxamide (PubChem CID 64608248) has the molecular formula C10H12ClN3O4S and a molecular weight of 305.74 g/mol. Its IUPAC name is 1-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 64608248 |
| Molecular Formula | C10H12ClN3O4S |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 1-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1S(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C10H12ClN3O4S/c11-7-4-6(5-13-10(7)16)19(17,18)14-3-1-2-8(14)9(12)15/h4-5,8H,1-3H2,(H2,12,15)(H,13,16) |
| InChIKey | OLDXTGSVWVYKJT-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |